cas: 2173107-06-5 — see every product listed under this CAS number, including other names
7-Tosyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine, 95%, 95% (CAS 2173107-06-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JVFB-100mg |
| cas | 2173107-06-5 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1782.80 Pln | |
| Chemat | 250mg | 2819.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidin-4-amine (CAS 2173107-06-5) is a chemical compound with the molecular formula C13H12N4O2S and a molecular weight of 288.33 g/mol. IUPAC name: 7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidin-4-amine. InChIKey: OIQONGZISGHCTC-UHFFFAOYSA-N.
| Molecular formula | C13H12N4O2S |
|---|---|
| Molecular weight | 288.33 g/mol |
| IUPAC name | 7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidin-4-amine |
| InChIKey | OIQONGZISGHCTC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C=CC3=C(N=CN=C32)N |
Computed by PubChem (NCBI)