cas: 24391-41-1 — see every product listed under this CAS number, including other names
7H-Pyrrolo[2,3-d]pyrimidine-5-carbonitrile, 4-chloro-, 98%, 98% (CAS 24391-41-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118NIQ-100mg |
| cas | 24391-41-1 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 126.80 Pln | |
| Chemat | 500mg | 198.80 Pln | |
| Chemat | 1g | 232.40 Pln | |
| Chemat | 5g | 741.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-chloro-7H-pyrrolo[2,3-d]pyrimidine-5-carbonitrile (CAS 24391-41-1) is a chemical compound with the molecular formula C7H3ClN4 and a molecular weight of 178.58 g/mol. IUPAC name: 4-chloro-7H-pyrrolo[2,3-d]pyrimidine-5-carbonitrile. InChIKey: NEWCOPCSNFUQQY-UHFFFAOYSA-N.
| Molecular formula | C7H3ClN4 |
|---|---|
| Molecular weight | 178.58 g/mol |
| IUPAC name | 4-chloro-7H-pyrrolo[2,3-d]pyrimidine-5-carbonitrile |
| InChIKey | NEWCOPCSNFUQQY-UHFFFAOYSA-N |
| SMILES | C1=C(C2=C(N1)N=CN=C2Cl)C#N |
Computed by PubChem (NCBI)