Products 2091665-05-1
CAS 2091665-05-1 is the registry number for 4-Chloropyrrolo[2,1-f][1,2,4]triazine-2-carbonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloropyrrolo[2,1-f][1,2,4]triazine-2-carbonitrile (CAS 2091665-05-1) is a chemical compound with the molecular formula C7H3ClN4 and a molecular weight of 178.58 g/mol. IUPAC name: 4-chloropyrrolo[2,1-f][1,2,4]triazine-2-carbonitrile. InChIKey: IVOLTFVSMNHSNI-UHFFFAOYSA-N.
| Molecular formula | C7H3ClN4 |
|---|---|
| Molecular weight | 178.58 g/mol |
| IUPAC name | 4-chloropyrrolo[2,1-f][1,2,4]triazine-2-carbonitrile |
| InChIKey | IVOLTFVSMNHSNI-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=C1)C(=NC(=N2)C#N)Cl |
Computed by PubChem (NCBI)