8-(Benzyloxy)-5,7-dibromoquinoline, 95%
cas: 84165-50-4 — see every product listed under this CAS number, including other names
8-(Benzyloxy)-5,7-dibromoquinoline, 95% (CAS 84165-50-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A218639-250mg |
| cas | 84165-50-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 214.62 Pln | |
| Ambeed | 5g | 548.38 Pln | |
| Ambeed | 10g | 837.62 Pln | |
| BLDpharm | 250mg | 125.54 Pln | |
| BLDpharm | 1g | 208.84 Pln | |
| BLDpharm | 5g | 536.50 Pln | |
| BLDpharm | 10g | 819.74 Pln | |
| Fluorochem | 250mg | 180.16 Pln | |
| Fluorochem | 1g | 341.56 Pln | |
| Fluorochem | 5g | 961.14 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
5,7-dibromo-8-phenylmethoxyquinoline (CAS 84165-50-4) is a chemical compound with the molecular formula C16H11Br2NO and a molecular weight of 393.07 g/mol. IUPAC name: 5,7-dibromo-8-phenylmethoxyquinoline. InChIKey: GLRLAIQRBWDBGX-UHFFFAOYSA-N.
| Molecular formula | C16H11Br2NO |
|---|---|
| Molecular weight | 393.07 g/mol |
| IUPAC name | 5,7-dibromo-8-phenylmethoxyquinoline |
| InChIKey | GLRLAIQRBWDBGX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C3=C2N=CC=C3)Br)Br |
Computed by PubChem (NCBI)