CAS 84165-50-4 appears in our catalog under these names: 8-(Benzyloxy)-5,7-dibromoquinoline 95%, 5,7-dibromo-8-benzyloxyquinoline, 95%, 95%, 8-(BENZYLOXY)-5,7-DIBROMOQUINOLINE, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g.
5,7-dibromo-8-phenylmethoxyquinoline (CAS 84165-50-4) is a chemical compound with the molecular formula C16H11Br2NO and a molecular weight of 393.07 g/mol. IUPAC name: 5,7-dibromo-8-phenylmethoxyquinoline. InChIKey: GLRLAIQRBWDBGX-UHFFFAOYSA-N.
| Molecular formula | C16H11Br2NO |
|---|---|
| Molecular weight | 393.07 g/mol |
| IUPAC name | 5,7-dibromo-8-phenylmethoxyquinoline |
| InChIKey | GLRLAIQRBWDBGX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C3=C2N=CC=C3)Br)Br |
Computed by PubChem (NCBI)