cas: 1160247-17-5 — see every product listed under this CAS number, including other names
8-(tert-Butoxycarbonyl)-8-azaspiro[4.5]decane-2-carboxylic acid, >95%, >95% (CAS 1160247-17-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111BFA-100mg |
| cas | 1160247-17-5 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1062.80 Pln | |
| Chemat | 250mg | 2094.80 Pln | |
| Chemat | 1g | 5920.40 Pln | |
| Chemat | 5g | 18669.20 Pln |
| purity | >95% |
|---|---|
| delivery time | 3 weeks |
8-[(2-methylpropan-2-yl)oxycarbonyl]-8-azaspiro[4.5]decane-3-carboxylic acid (CAS 1160247-17-5) is a chemical compound with the molecular formula C15H25NO4 and a molecular weight of 283.36 g/mol. IUPAC name: 8-[(2-methylpropan-2-yl)oxycarbonyl]-8-azaspiro[4.5]decane-3-carboxylic acid. InChIKey: XOUMCYVKNAETFA-UHFFFAOYSA-N.
| Molecular formula | C15H25NO4 |
|---|---|
| Molecular weight | 283.36 g/mol |
| IUPAC name | 8-[(2-methylpropan-2-yl)oxycarbonyl]-8-azaspiro[4.5]decane-3-carboxylic acid |
| InChIKey | XOUMCYVKNAETFA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CCC(C2)C(=O)O)CC1 |
Computed by PubChem (NCBI)