cas: 1363381-43-4 — see every product listed under this CAS number, including other names
8-BOC-2-OXO-3-OXA-1,8-DIAZA-SPIRO[5.5]UNDECANE (CAS 1363381-43-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F468010-100MG |
| cas | 1363381-43-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1731.70 Pln | |
| Fluorochem | 250mg | 2726.14 Pln | |
| Fluorochem | 1g | 10634.81 Pln |
| delivery time | 3-4 weeks |
|---|
Tert-butyl 2-oxo-3-oxa-1,8-diazaspiro[5.5]undecane-8-carboxylate (CAS 1363381-43-4) is a chemical compound with the molecular formula C13H22N2O4 and a molecular weight of 270.32 g/mol. IUPAC name: tert-butyl 2-oxo-3-oxa-1,8-diazaspiro[5.5]undecane-8-carboxylate. InChIKey: PSJVWIIBVVDMHJ-UHFFFAOYSA-N.
| Molecular formula | C13H22N2O4 |
|---|---|
| Molecular weight | 270.32 g/mol |
| IUPAC name | tert-butyl 2-oxo-3-oxa-1,8-diazaspiro[5.5]undecane-8-carboxylate |
| InChIKey | PSJVWIIBVVDMHJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC2(C1)CCOC(=O)N2 |
Computed by PubChem (NCBI)