cas: 1384187-12-5 — see every product listed under this CAS number, including other names
8-BROMOBENZOFURO[3,2-B]PYRIDINE, ≥95% (CAS 1384187-12-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F852913-100MG |
| cas | 1384187-12-5 |
| size | 100mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1237.08 Pln | |
| Fluorochem | 250mg | 1804.59 Pln | |
| Fluorochem | 1g | 4355.78 Pln | |
| Fluorochem | 5g | 8796.92 Pln | |
| Fluorochem | 10g | 12540.39 Pln | |
| Chemat | 100mg | 741.20 Pln | |
| Chemat | 250mg | 1082.00 Pln | |
| Chemat | 1g | 2613.20 Pln | |
| Chemat | 5g | 5368.40 Pln | |
| Chemat | 10g | 7643.60 Pln |
| purity | ≥95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
8-bromo-[1]benzofuro[3,2-b]pyridine (CAS 1384187-12-5) is a chemical compound with the molecular formula C11H6BrNO and a molecular weight of 248.07 g/mol. IUPAC name: 8-bromo-[1]benzofuro[3,2-b]pyridine. InChIKey: CFXLXMCOYUXSFI-UHFFFAOYSA-N.
| Molecular formula | C11H6BrNO |
|---|---|
| Molecular weight | 248.07 g/mol |
| IUPAC name | 8-bromo-[1]benzofuro[3,2-b]pyridine |
| InChIKey | CFXLXMCOYUXSFI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C3=C(O2)C=CC(=C3)Br)N=C1 |
Computed by PubChem (NCBI)