CAS 550998-30-6 is the registry number for 3-Bromo-7-hydroxy-1-naphthonitrile, 97%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
3-bromo-7-hydroxynaphthalene-1-carbonitrile (CAS 550998-30-6) is a chemical compound with the molecular formula C11H6BrNO and a molecular weight of 248.07 g/mol. IUPAC name: 3-bromo-7-hydroxynaphthalene-1-carbonitrile. InChIKey: RGAMVVJGWSZBFJ-UHFFFAOYSA-N.
| Molecular formula | C11H6BrNO |
|---|---|
| Molecular weight | 248.07 g/mol |
| IUPAC name | 3-bromo-7-hydroxynaphthalene-1-carbonitrile |
| InChIKey | RGAMVVJGWSZBFJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C(C=C(C=C21)Br)C#N)O |
Computed by PubChem (NCBI)