cas: 65340-71-8 — see every product listed under this CAS number, including other names
8-Bromo-4-chloroquinoline, 95% (CAS 65340-71-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F223663-250MG |
| cas | 65340-71-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 159.34 Pln | |
| Fluorochem | 1g | 221.81 Pln | |
| Fluorochem | 5g | 690.40 Pln | |
| Fluorochem | 25g | 2377.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
8-bromo-4-chloroquinoline (CAS 65340-71-8) is a chemical compound with the molecular formula C9H5BrClN and a molecular weight of 242.50 g/mol. IUPAC name: 8-bromo-4-chloroquinoline. InChIKey: DAHYJSFUKJLEEJ-UHFFFAOYSA-N.
| Molecular formula | C9H5BrClN |
|---|---|
| Molecular weight | 242.50 g/mol |
| IUPAC name | 8-bromo-4-chloroquinoline |
| InChIKey | DAHYJSFUKJLEEJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN=C2C(=C1)Br)Cl |
Computed by PubChem (NCBI)