cas: 666816-98-4 — see every product listed under this CAS number, including other names
8-Bromo-7-(but-2-yn-1-yl)-3-methyl-1H-purine-2,6(3H,7H)-dione, 98%, 98% (CAS 666816-98-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1147ZB-1g |
| cas | 666816-98-4 |
| size | 1g |
| availability | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 83.60 Pln | |
| Chemat | 10g | 107.60 Pln | |
| Chemat | 25g | 165.20 Pln | |
| Chemat | 50g | 266.00 Pln | |
| Chemat | 100g | 472.40 Pln | |
| Chemat | 250g | 928.40 Pln | |
| Chemat | 500g | 1560.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
8-bromo-7-but-2-ynyl-3-methylpurine-2,6-dione (CAS 666816-98-4) is a chemical compound with the molecular formula C10H9BrN4O2 and a molecular weight of 297.11 g/mol. IUPAC name: 8-bromo-7-but-2-ynyl-3-methylpurine-2,6-dione. InChIKey: HFZOBQSHTNNKFY-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN4O2 |
|---|---|
| Molecular weight | 297.11 g/mol |
| IUPAC name | 8-bromo-7-but-2-ynyl-3-methylpurine-2,6-dione |
| InChIKey | HFZOBQSHTNNKFY-UHFFFAOYSA-N |
| SMILES | CC#CCN1C2=C(N=C1Br)N(C(=O)NC2=O)C |
Computed by PubChem (NCBI)