CAS 1269292-57-0 is the registry number for Ethyl 5-bromo-1-(pyrimidin-2-yl)-1h-pyrazole-4-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
Ethyl 5-bromo-1-pyrimidin-2-ylpyrazole-4-carboxylate (CAS 1269292-57-0) is a chemical compound with the molecular formula C10H9BrN4O2 and a molecular weight of 297.11 g/mol. IUPAC name: ethyl 5-bromo-1-pyrimidin-2-ylpyrazole-4-carboxylate. InChIKey: WHTZCXXAXMJGFF-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN4O2 |
|---|---|
| Molecular weight | 297.11 g/mol |
| IUPAC name | ethyl 5-bromo-1-pyrimidin-2-ylpyrazole-4-carboxylate |
| InChIKey | WHTZCXXAXMJGFF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(N=C1)C2=NC=CC=N2)Br |
Computed by PubChem (NCBI)