cas: 115662-09-4 — see every product listed under this CAS number, including other names
8-Hydroxy-1,1,7,7-tetramethyljulolidine-9-carboxaldehyde, 97%, 97% (CAS 115662-09-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 200mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111GP2-100mg |
| cas | 115662-09-4 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 200mg | 117.20 Pln | |
| Chemat | 250mg | 122.00 Pln | |
| Chemat | 1g | 218.00 Pln | |
| Chemat | 5g | 741.20 Pln | |
| Chemat | 25g | 3237.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
6-hydroxy-4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene-7-carbaldehyde (CAS 115662-09-4) is a chemical compound with the molecular formula C17H23NO2 and a molecular weight of 273.37 g/mol. IUPAC name: 6-hydroxy-4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene-7-carbaldehyde. InChIKey: ZBVWJSQPIHQKQJ-UHFFFAOYSA-N.
| Molecular formula | C17H23NO2 |
|---|---|
| Molecular weight | 273.37 g/mol |
| IUPAC name | 6-hydroxy-4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene-7-carbaldehyde |
| InChIKey | ZBVWJSQPIHQKQJ-UHFFFAOYSA-N |
| SMILES | CC1(CCN2CCC(C3=C(C(=CC1=C32)C=O)O)(C)C)C |
Computed by PubChem (NCBI)