CAS 2096112-88-6 is the registry number for 1-(1-Acetyl-2,2,4,8-tetramethyl-1,2,3,4-tetrahydroquinolin-7-yl)ethanone, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
1-(1-acetyl-2,2,4,8-tetramethyl-3,4-dihydroquinolin-7-yl)ethanone (CAS 2096112-88-6) is a chemical compound with the molecular formula C17H23NO2 and a molecular weight of 273.37 g/mol. IUPAC name: 1-(1-acetyl-2,2,4,8-tetramethyl-3,4-dihydroquinolin-7-yl)ethanone. InChIKey: NEGPMIYRDYQNHW-UHFFFAOYSA-N.
| Molecular formula | C17H23NO2 |
|---|---|
| Molecular weight | 273.37 g/mol |
| IUPAC name | 1-(1-acetyl-2,2,4,8-tetramethyl-3,4-dihydroquinolin-7-yl)ethanone |
| InChIKey | NEGPMIYRDYQNHW-UHFFFAOYSA-N |
| SMILES | CC1CC(N(C2=C1C=CC(=C2C)C(=O)C)C(=O)C)(C)C |
Computed by PubChem (NCBI)