cas: 17537-86-9 — see every product listed under this CAS number, including other names
8-Methoxy-2,3,4,5-tetrahydro-1h-benzo[b]azepine hydrochloride, 97% (CAS 17537-86-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F638403-100MG |
| cas | 17537-86-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 435.28 Pln | |
| Fluorochem | 250mg | 518.59 Pln | |
| Fluorochem | 1g | 1309.97 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
8-methoxy-2,3,4,5-tetrahydro-1H-1-benzazepine;hydrochloride (CAS 17537-86-9) is a chemical compound with the molecular formula C11H16ClNO and a molecular weight of 213.70 g/mol. IUPAC name: 8-methoxy-2,3,4,5-tetrahydro-1H-1-benzazepine;hydrochloride. InChIKey: KOAFDAMJTMINMX-UHFFFAOYSA-N.
| Molecular formula | C11H16ClNO |
|---|---|
| Molecular weight | 213.70 g/mol |
| IUPAC name | 8-methoxy-2,3,4,5-tetrahydro-1H-1-benzazepine;hydrochloride |
| InChIKey | KOAFDAMJTMINMX-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(CCCCN2)C=C1.Cl |
Computed by PubChem (NCBI)