cas: 1381869-21-1 — see every product listed under this CAS number, including other names
8-bromo-2-phenylimidazo[1,2-a]pyridine, 97%, 97% (CAS 1381869-21-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch129E74-250mg |
| cas | 1381869-21-1 |
| size | 250mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 938.00 Pln | |
| Chemat | 1g | 2522.00 Pln | |
| Chemat | 5g | 11138.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
8-bromo-2-phenylimidazo[1,2-a]pyridine (CAS 1381869-21-1) is a chemical compound with the molecular formula C13H9BrN2 and a molecular weight of 273.13 g/mol. IUPAC name: 8-bromo-2-phenylimidazo[1,2-a]pyridine. InChIKey: YBBVZYAWDUKLLJ-UHFFFAOYSA-N.
| Molecular formula | C13H9BrN2 |
|---|---|
| Molecular weight | 273.13 g/mol |
| IUPAC name | 8-bromo-2-phenylimidazo[1,2-a]pyridine |
| InChIKey | YBBVZYAWDUKLLJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CN3C=CC=C(C3=N2)Br |
Computed by PubChem (NCBI)