CAS 1381869-21-1 appears in our catalog under these names: 8-Bromo-2-phenylimidazo[1,2-a]pyridine, 98%, 8-bromo-2-phenylimidazo[1,2-a]pyridine, 97%, 97%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 250mg, 1g, 5g.
8-bromo-2-phenylimidazo[1,2-a]pyridine (CAS 1381869-21-1) is a chemical compound with the molecular formula C13H9BrN2 and a molecular weight of 273.13 g/mol. IUPAC name: 8-bromo-2-phenylimidazo[1,2-a]pyridine. InChIKey: YBBVZYAWDUKLLJ-UHFFFAOYSA-N.
| Molecular formula | C13H9BrN2 |
|---|---|
| Molecular weight | 273.13 g/mol |
| IUPAC name | 8-bromo-2-phenylimidazo[1,2-a]pyridine |
| InChIKey | YBBVZYAWDUKLLJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CN3C=CC=C(C3=N2)Br |
Computed by PubChem (NCBI)