cas: 122648-99-1 — see every product listed under this CAS number, including other names
9,10-Di(naphthalen-2-yl)anthracene, 97%, 97% (CAS 122648-99-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1128KZ-250mg |
| cas | 122648-99-1 |
| size | 250mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 155.60 Pln | |
| Chemat | 5g | 506.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
9,10-dinaphthalen-2-ylanthracene (CAS 122648-99-1) is a chemical compound with the molecular formula C34H22 and a molecular weight of 430.5 g/mol. IUPAC name: 9,10-dinaphthalen-2-ylanthracene. InChIKey: VIZUPBYFLORCRA-UHFFFAOYSA-N.
| Molecular formula | C34H22 |
|---|---|
| Molecular weight | 430.5 g/mol |
| IUPAC name | 9,10-dinaphthalen-2-ylanthracene |
| InChIKey | VIZUPBYFLORCRA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C3=C4C=CC=CC4=C(C5=CC=CC=C53)C6=CC7=CC=CC=C7C=C6 |
Computed by PubChem (NCBI)