CAS 76727-11-2 appears in our catalog under these names: Poly((9,9-dihexylfluorenyl-2,7-diyl)-alt-(2-methoxy-5-{2-ethylhexyloxy}-1,4-phenylene)), 6,13-Diphenylpentacene, 95%, 6,13-Diphenylpentacene, 95-<97%, 6,13-Diphenylpentacene, ≥97-<99%, 6,13-Diphenylpentacene, 97%. Offered by: Lumtec, Combi-blocks, Hoffman Fine Chemicals, AmBeed, GLPBio. Available pack sizes: On request, 200mg, 2,5g, 5g, 10g, 25g, 50g, 100mg.
6,13-diphenylpentacene (CAS 76727-11-2) is a chemical compound with the molecular formula C34H22 and a molecular weight of 430.5 g/mol. IUPAC name: 6,13-diphenylpentacene. InChIKey: PFCSVQKCECNEAZ-UHFFFAOYSA-N.
| Molecular formula | C34H22 |
|---|---|
| Molecular weight | 430.5 g/mol |
| IUPAC name | 6,13-diphenylpentacene |
| InChIKey | PFCSVQKCECNEAZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C3C=C4C=CC=CC4=CC3=C(C5=CC6=CC=CC=C6C=C52)C7=CC=CC=C7 |
Computed by PubChem (NCBI)