cas: 20474-15-1 — see every product listed under this CAS number, including other names
9,10-dihydro-9,9-diphenylacridin, 98% (CAS 20474-15-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 15g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1130OD-100mg |
| cas | 20474-15-1 |
| size | 100mg |
| availability | 300g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 131.60 Pln | |
| Chemat | 5g | 328.40 Pln | |
| Chemat | 10g | 587.60 Pln | |
| Chemat | 15g | 827.60 Pln | |
| Chemat | 25g | 1134.80 Pln | |
| Chemat | 50g | 2099.60 Pln | |
| Chemat | 75g | 3083.60 Pln | |
| Chemat | 100g | 3390.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
9,9-diphenyl-10H-acridine (CAS 20474-15-1) is a chemical compound with the molecular formula C25H19N and a molecular weight of 333.4 g/mol. IUPAC name: 9,9-diphenyl-10H-acridine. InChIKey: HWTHOPMRUCFPBX-UHFFFAOYSA-N.
| Molecular formula | C25H19N |
|---|---|
| Molecular weight | 333.4 g/mol |
| IUPAC name | 9,9-diphenyl-10H-acridine |
| InChIKey | HWTHOPMRUCFPBX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2(C3=CC=CC=C3NC4=CC=CC=C42)C5=CC=CC=C5 |
Computed by PubChem (NCBI)