CAS 54941-50-3 appears in our catalog under these names: 9,9-Di-p-tolyl-9h-fluorene, 95%, 9,9–Di(p–tolyl)fluorene, 9,9-Di(p-tolyl)fluorene, >98.0%(GC), 9,9-Di-p-tolyl-9H-fluorene, ≥98%, ≥98%, 9,9-Bis(4-methylphenyl)-9H-fluorene, ≥98%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 25g.
9,9-bis(4-methylphenyl)fluorene (CAS 54941-50-3) is a chemical compound with the molecular formula C27H22 and a molecular weight of 346.5 g/mol. IUPAC name: 9,9-bis(4-methylphenyl)fluorene. InChIKey: ARZDANJGUJGWIO-UHFFFAOYSA-N.
| Molecular formula | C27H22 |
|---|---|
| Molecular weight | 346.5 g/mol |
| IUPAC name | 9,9-bis(4-methylphenyl)fluorene |
| InChIKey | ARZDANJGUJGWIO-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2(C3=CC=CC=C3C4=CC=CC=C42)C5=CC=C(C=C5)C |
Computed by PubChem (NCBI)