CAS 70592-06-2 appears in our catalog under these names: (2–(P–tolyl)ethene–1,1,2–triyl)tribenzene, (2-(p-Tolyl)ethene-1,1,2-triyl)tribenzene 97%, (2-(P-tolyl)ethene-1,1,2-triyl)tribenzene, 97%, 1-methyl-4-(1,2,2-triphenylethenyl)benzene, 97%, 97%. Offered by: GLPBio, Ambeed, Fluorochem, Chemat. Available pack sizes: 25g, 5g, 250mg, 1g, 10g, 100mg.
1-methyl-4-(1,2,2-triphenylethenyl)benzene (CAS 70592-06-2) is a chemical compound with the molecular formula C27H22 and a molecular weight of 346.5 g/mol. IUPAC name: 1-methyl-4-(1,2,2-triphenylethenyl)benzene. InChIKey: CNZZQDOFHHSVMJ-UHFFFAOYSA-N.
| Molecular formula | C27H22 |
|---|---|
| Molecular weight | 346.5 g/mol |
| IUPAC name | 1-methyl-4-(1,2,2-triphenylethenyl)benzene |
| InChIKey | CNZZQDOFHHSVMJ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=C(C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)