cas: 959246-70-9 — see every product listed under this CAS number, including other names
9,9-Dimethyl-9H-fluoren-2-ol, 98%, 98% (CAS 959246-70-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IJJN-250mg |
| cas | 959246-70-9 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 150.80 Pln | |
| Chemat | 1g | 304.40 Pln | |
| Chemat | 5g | 909.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
9,9-dimethylfluoren-2-ol (CAS 959246-70-9) is a chemical compound with the molecular formula C15H14O and a molecular weight of 210.27 g/mol. IUPAC name: 9,9-dimethylfluoren-2-ol. InChIKey: FEHWLBQCZZOZBU-UHFFFAOYSA-N.
| Molecular formula | C15H14O |
|---|---|
| Molecular weight | 210.27 g/mol |
| IUPAC name | 9,9-dimethylfluoren-2-ol |
| InChIKey | FEHWLBQCZZOZBU-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC=C2C3=C1C=C(C=C3)O)C |
Computed by PubChem (NCBI)