CAS 24126-82-7 appears in our catalog under these names: 4-Cinnamylphenol, 95%, 4-Cinnamylphenol, 4-(3-Phenylallyl)phenol 97%. Offered by: Combi-blocks, Biosynth, Ambeed. Available pack sizes: 1g, 25g, 10g, 5g, 100mg, 250mg.
4-[(E)-3-phenylprop-2-enyl]phenol (CAS 24126-82-7) is a chemical compound with the molecular formula C15H14O and a molecular weight of 210.27 g/mol. IUPAC name: 4-[(E)-3-phenylprop-2-enyl]phenol. InChIKey: YNPGXIGIEYOFEX-QPJJXVBHSA-N.
| Molecular formula | C15H14O |
|---|---|
| Molecular weight | 210.27 g/mol |
| IUPAC name | 4-[(E)-3-phenylprop-2-enyl]phenol |
| InChIKey | YNPGXIGIEYOFEX-QPJJXVBHSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/CC2=CC=C(C=C2)O |
Computed by PubChem (NCBI)