9-([1,1'-Biphenyl]-3-yl)-2-bromo-9H-carbazole, 98%
cas: 1656983-68-4 — see every product listed under this CAS number, including other names
9-([1,1'-Biphenyl]-3-yl)-2-bromo-9H-carbazole, 98% (CAS 1656983-68-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1214189-250mg |
| cas | 1656983-68-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 337.00 Pln | |
| Ambeed | 5g | 865.44 Pln | |
| Ambeed | 25g | 2450.75 Pln | |
| BLDpharm | 250mg | 214.39 Pln | |
| BLDpharm | 1g | 353.23 Pln | |
| BLDpharm | 5g | 925.25 Pln | |
| BLDpharm | 25g | 2635.76 Pln | |
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 141.20 Pln | |
| Chemat | 1g | 299.60 Pln | |
| Chemat | 5g | 770.00 Pln | |
| Chemat | 25g | 2176.40 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
2-bromo-9-(3-phenylphenyl)carbazole (CAS 1656983-68-4) is a chemical compound with the molecular formula C24H16BrN and a molecular weight of 398.3 g/mol. IUPAC name: 2-bromo-9-(3-phenylphenyl)carbazole. InChIKey: RLRTZTBYUWXHGT-UHFFFAOYSA-N.
| Molecular formula | C24H16BrN |
|---|---|
| Molecular weight | 398.3 g/mol |
| IUPAC name | 2-bromo-9-(3-phenylphenyl)carbazole |
| InChIKey | RLRTZTBYUWXHGT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC=C2)N3C4=CC=CC=C4C5=C3C=C(C=C5)Br |
Computed by PubChem (NCBI)