9-([1,1'-Biphenyl]-3-yl)-9H-carbazole, 97%
cas: 1221237-87-1 — see every product listed under this CAS number, including other names
9-([1,1'-Biphenyl]-3-yl)-9H-carbazole, 97% (CAS 1221237-87-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A140428-250mg |
| cas | 1221237-87-1 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 259.12 Pln | |
| Ambeed | 10g | 353.69 Pln | |
| Ambeed | 25g | 526.12 Pln | |
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 203.60 Pln | |
| Chemat | 10g | 314.00 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 275.48 Pln | |
| BLDpharm | 10g | 375.45 Pln | |
| BLDpharm | 25g | 558.72 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
9-(3-phenylphenyl)carbazole (CAS 1221237-87-1) is a chemical compound with the molecular formula C24H17N and a molecular weight of 319.4 g/mol. IUPAC name: 9-(3-phenylphenyl)carbazole. InChIKey: LKXFMLDAUIXMGY-UHFFFAOYSA-N.
| Molecular formula | C24H17N |
|---|---|
| Molecular weight | 319.4 g/mol |
| IUPAC name | 9-(3-phenylphenyl)carbazole |
| InChIKey | LKXFMLDAUIXMGY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC=C2)N3C4=CC=CC=C4C5=CC=CC=C53 |
Computed by PubChem (NCBI)