CAS 1643526-99-1 is the registry number for 3-([1,1'-Biphenyl]-3-yl)-9H-carbazole, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g.
3-(3-phenylphenyl)-9H-carbazole (CAS 1643526-99-1) is a chemical compound with the molecular formula C24H17N and a molecular weight of 319.4 g/mol. IUPAC name: 3-(3-phenylphenyl)-9H-carbazole. InChIKey: LBCQASKYIUIWKB-UHFFFAOYSA-N.
| Molecular formula | C24H17N |
|---|---|
| Molecular weight | 319.4 g/mol |
| IUPAC name | 3-(3-phenylphenyl)-9H-carbazole |
| InChIKey | LBCQASKYIUIWKB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC=C2)C3=CC4=C(C=C3)NC5=CC=CC=C54 |
Computed by PubChem (NCBI)