9-(2-Bromo-3-fluorophenyl)-9H-carbazole, 95%
cas: 2401590-26-7 — see every product listed under this CAS number, including other names
9-(2-Bromo-3-fluorophenyl)-9H-carbazole, 95% (CAS 2401590-26-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1963376-250mg |
| cas | 2401590-26-7 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 181.25 Pln | |
| Ambeed | 1g | 353.69 Pln | |
| Ambeed | 5g | 1004.50 Pln | |
| Ambeed | 10g | 1566.31 Pln | |
| BLDpharm | 250mg | 169.96 Pln | |
| BLDpharm | 1g | 347.68 Pln | |
| BLDpharm | 5g | 986.34 Pln | |
| BLDpharm | 10g | 1541.70 Pln | |
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 256.40 Pln | |
| Chemat | 5g | 698.00 Pln | |
| Fluorochem | 5g | 1039.24 Pln | |
| Fluorochem | 10g | 1622.36 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
9-(2-bromo-3-fluorophenyl)carbazole (CAS 2401590-26-7) is a chemical compound with the molecular formula C18H11BrFN and a molecular weight of 340.2 g/mol. IUPAC name: 9-(2-bromo-3-fluorophenyl)carbazole. InChIKey: CQLOSTJLLKKUQN-UHFFFAOYSA-N.
| Molecular formula | C18H11BrFN |
|---|---|
| Molecular weight | 340.2 g/mol |
| IUPAC name | 9-(2-bromo-3-fluorophenyl)carbazole |
| InChIKey | CQLOSTJLLKKUQN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3N2C4=C(C(=CC=C4)F)Br |
Computed by PubChem (NCBI)