CAS 922721-30-0 appears in our catalog under these names: 3-Bromo-9-(4-fluorophenyl)-9h-carbazole, 95%, 3–Bromo–9–(4–fluorophenyl)–9H–carbazole, 3-Bromo-9-(4-fluorophenyl)-9H-carbazole, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g.
3-bromo-9-(4-fluorophenyl)carbazole (CAS 922721-30-0) is a chemical compound with the molecular formula C18H11BrFN and a molecular weight of 340.2 g/mol. IUPAC name: 3-bromo-9-(4-fluorophenyl)carbazole. InChIKey: SFUNDIMWQUSCGD-UHFFFAOYSA-N.
| Molecular formula | C18H11BrFN |
|---|---|
| Molecular weight | 340.2 g/mol |
| IUPAC name | 3-bromo-9-(4-fluorophenyl)carbazole |
| InChIKey | SFUNDIMWQUSCGD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2C4=CC=C(C=C4)F)C=CC(=C3)Br |
Computed by PubChem (NCBI)