cas: 38819-10-2 — see every product listed under this CAS number, including other names
9-β-D-Arabinofuranosylguanine 98% (CAS 38819-10-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A172052-250mg |
| cas | 38819-10-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 186.81 Pln | |
| Ambeed | 1g | 342.56 Pln | |
| Ambeed | 5g | 937.75 Pln | |
| Ambeed | 25g | 3318.50 Pln | |
| Ambeed | 100g | 8658.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A172052 |
9-beta-D-arabinofuranosylguanine is a purine nucleoside in which guanine is attached to arabinofuranose via a beta-N9-glycosidic bond. It inhibits DNA synthesis and causes cell death. It has a role as an antineoplastic agent and a DNA synthesis inhibitor. It is a purine nucleoside and a beta-D-arabinoside.
Source: ChEBI
| Molecular formula | C10H13N5O5 |
|---|---|
| Molecular weight | 283.24 g/mol |
| IUPAC name | 2-amino-9-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
| InChIKey | NYHBQMYGNKIUIF-FJFJXFQQSA-N |
| SMILES | C1=NC2=C(N1[C@H]3[C@H]([C@@H]([C@H](O3)CO)O)O)N=C(NC2=O)N |
Computed by PubChem (NCBI)