CAS 13389-16-7 appears in our catalog under these names: (2R,3R,4S,5R)-2-(8-Amino-6-hydroxy-9H-purin-9-yl)-5-(hydroxymethyl)tetrahydrofuran-3,4-diol, 97%, 8-Amino-Inosine. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 10mg.
8-amino-9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one (CAS 13389-16-7) is a chemical compound with the molecular formula C10H13N5O5 and a molecular weight of 283.24 g/mol. IUPAC name: 8-amino-9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one. InChIKey: OBCXRIVPFSZZSN-UHFFFAOYSA-N.
| Molecular formula | C10H13N5O5 |
|---|---|
| Molecular weight | 283.24 g/mol |
| IUPAC name | 8-amino-9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
| InChIKey | OBCXRIVPFSZZSN-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(C(=O)N1)N=C(N2C3C(C(C(O3)CO)O)O)N |
Computed by PubChem (NCBI)