9-Amino minocycline HCl 96% HPLC
cas: 149934-21-4 — see every product listed under this CAS number, including other names
9-Amino minocycline HCl 96% HPLC (CAS 149934-21-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A212709-250mg |
| cas | 149934-21-4 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 164.56 Pln | |
| Ambeed | 1g | 225.75 Pln | |
| Ambeed | 5g | 553.94 Pln | |
| Ambeed | 25g | 2267.19 Pln |
properties
| purity | 96% HPLC |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A212709 |
(4S,4aS,5aR,12aR)-9-amino-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;hydrochloride (CAS 149934-21-4) is a chemical compound with the molecular formula C23H29ClN4O7 and a molecular weight of 508.9 g/mol. IUPAC name: (4S,4aS,5aR,12aR)-9-amino-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;hydrochloride. InChIKey: MQRUQMWLTBRONP-KBTHSJHISA-N.
| Molecular formula | C23H29ClN4O7 |
|---|---|
| Molecular weight | 508.9 g/mol |
| IUPAC name | (4S,4aS,5aR,12aR)-9-amino-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;hydrochloride |
| InChIKey | MQRUQMWLTBRONP-KBTHSJHISA-N |
| SMILES | CN(C)[C@H]1[C@@H]2C[C@@H]3CC4=C(C=C(C(=C4C(=C3C(=O)[C@@]2(C(=C(C1=O)C(=O)N)O)O)O)O)N)N(C)C.Cl |
Computed by PubChem (NCBI)
Synonyms:
9-Amino minocycline hydrochloride, 9-Aminominocycline Hydrochloride, 9-Amino-minocycline hydrochloride, 9-Minocycline HCL, 9-Amino Minocycline HCl, C23H29ClN4O7, 9-Aminominocycline Hydrochloride (~90%), 9-Aminominocycline Hydrochloride (~90per cent), 9-Aminominocycline HCl, Tigecycline Impurity 12