cas: 1023595-19-8 — see every product listed under this CAS number, including other names
9-Boc-2,9-diazaspiro[5.5]undecane, 98%, 98% (CAS 1023595-19-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 10g, 250mg, 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11189S-100mg |
| cas | 1023595-19-8 |
| size | 100mg |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 10g | 746.00 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 174.80 Pln | |
| Chemat | 5g | 477.20 Pln | |
| Chemat | 25g | 1514.00 Pln | |
| Chemat | 100g | 5166.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 2,9-diazaspiro[5.5]undecane-9-carboxylate (CAS 1023595-19-8) is a chemical compound with the molecular formula C14H26N2O2 and a molecular weight of 254.37 g/mol. IUPAC name: tert-butyl 2,9-diazaspiro[5.5]undecane-9-carboxylate. InChIKey: QDWTYWWOUAIWGI-UHFFFAOYSA-N.
| Molecular formula | C14H26N2O2 |
|---|---|
| Molecular weight | 254.37 g/mol |
| IUPAC name | tert-butyl 2,9-diazaspiro[5.5]undecane-9-carboxylate |
| InChIKey | QDWTYWWOUAIWGI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CCCNC2)CC1 |
Computed by PubChem (NCBI)