9-Phenanthrenecarboxylic acid, 96%
cas: 837-45-6 — see every product listed under this CAS number, including other names
9-Phenanthrenecarboxylic acid, 96% (CAS 837-45-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F342257-100MG |
| cas | 837-45-6 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 154.13 Pln | |
| Fluorochem | 250mg | 190.58 Pln | |
| Fluorochem | 500mg | 320.74 Pln | |
| Fluorochem | 1g | 351.98 Pln | |
| Fluorochem | 5g | 1106.92 Pln | |
| Fluorochem | 10g | 2158.63 Pln | |
| Fluorochem | 25g | 5298.15 Pln |
properties
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
Phenanthrene-9-carboxylic acid (CAS 837-45-6) is a chemical compound with the molecular formula C15H10O2 and a molecular weight of 222.24 g/mol. IUPAC name: phenanthrene-9-carboxylic acid. InChIKey: LMFJKKGDLAICPF-UHFFFAOYSA-N.
| Molecular formula | C15H10O2 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | phenanthrene-9-carboxylic acid |
| InChIKey | LMFJKKGDLAICPF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C3=CC=CC=C23)C(=O)O |
Computed by PubChem (NCBI)