cas: 525-03-1 — see every product listed under this CAS number, including other names
9H-Fluoren-9-amine, 97% (CAS 525-03-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F065053-250MG |
| cas | 525-03-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 206.20 Pln | |
| Fluorochem | 1g | 357.18 Pln | |
| Fluorochem | 5g | 1289.15 Pln | |
| Fluorochem | 10g | 2137.81 Pln | |
| Fluorochem | 25g | 4204.79 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
9H-fluoren-9-amine (CAS 525-03-1) is a chemical compound with the molecular formula C13H11N and a molecular weight of 181.23 g/mol. IUPAC name: 9H-fluoren-9-amine. InChIKey: OUGMRQJTULXVDC-UHFFFAOYSA-N.
| Molecular formula | C13H11N |
|---|---|
| Molecular weight | 181.23 g/mol |
| IUPAC name | 9H-fluoren-9-amine |
| InChIKey | OUGMRQJTULXVDC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)N |
Computed by PubChem (NCBI)