CAS 4630-20-0 appears in our catalog under these names: 3-Methyl-9h-carbazole, 95%, 3-Methyl-9H-carbazole, 95-<97%, 3-Methyl-9H-carbazole, ≥97-<99%, 3–Methylcarbazole, 3-Methylcarbazole/ 99.1% (existing batch purity). Offered by: Combi-blocks, Hoffman Fine Chemicals, GLPBio, TargetMol, TCI. Available pack sizes: 1g, 10g, 25g, 50g, 100g, 200g, 300g, 500mg.
3-methyl-9H-carbazole (CAS 4630-20-0) is a chemical compound with the molecular formula C13H11N and a molecular weight of 181.23 g/mol. IUPAC name: 3-methyl-9H-carbazole. InChIKey: PHKYYUQQYARDIU-UHFFFAOYSA-N.
| Molecular formula | C13H11N |
|---|---|
| Molecular weight | 181.23 g/mol |
| IUPAC name | 3-methyl-9H-carbazole |
| InChIKey | PHKYYUQQYARDIU-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)NC3=CC=CC=C32 |
Computed by PubChem (NCBI)