cas: 35598-63-1 — see every product listed under this CAS number, including other names
9H-Xanthen-9-amine 95% (CAS 35598-63-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A906130-100mg |
| cas | 35598-63-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 331.44 Pln | |
| Ambeed | 250mg | 542.81 Pln | |
| Ambeed | 1g | 1249.25 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A906130 |
9H-xanthen-9-amine (CAS 35598-63-1) is a chemical compound with the molecular formula C13H11NO and a molecular weight of 197.23 g/mol. IUPAC name: 9H-xanthen-9-amine. InChIKey: OTTYHRLXKGOXLY-UHFFFAOYSA-N.
| Molecular formula | C13H11NO |
|---|---|
| Molecular weight | 197.23 g/mol |
| IUPAC name | 9H-xanthen-9-amine |
| InChIKey | OTTYHRLXKGOXLY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C3O2)N |
Computed by PubChem (NCBI)