CAS 899507-36-9 appears in our catalog under these names: A 438079/ 99.7% (existing batch purity), A 438079, A 438079 98%, A 438079, 99.88%, A 438079 (Standard). Offered by: TargetMol, GLPBio, Ambeed, MedChemExpress, Chemat. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 5 mg.
3-[[5-(2,3-dichlorophenyl)tetrazol-1-yl]methyl]pyridine (CAS 899507-36-9) is a chemical compound with the molecular formula C13H9Cl2N5 and a molecular weight of 306.15 g/mol. IUPAC name: 3-[[5-(2,3-dichlorophenyl)tetrazol-1-yl]methyl]pyridine. InChIKey: MMPAULQSJLVKHP-UHFFFAOYSA-N.
| Molecular formula | C13H9Cl2N5 |
|---|---|
| Molecular weight | 306.15 g/mol |
| IUPAC name | 3-[[5-(2,3-dichlorophenyl)tetrazol-1-yl]methyl]pyridine |
| InChIKey | MMPAULQSJLVKHP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)C2=NN=NN2CC3=CN=CC=C3 |
Computed by PubChem (NCBI)