Products 1914989-80-2
CAS 1914989-80-2 appears in our catalog under these names: Aβ42–IN–2, Aβ42-IN-2/ 100%, Aβ42-IN-2, 98.00%, Aβ42-IN-2, 99.87% ,, 99.87% ,. Offered by: GLPBio, TargetMol, MedChemExpress, Chemat. Available pack sizes: 1mg, 10mg, 5mg, 10mM (in 1ml dmso), 2mg, 25mg, 50mg, 100mg.
6-[6-methoxy-5-(4-methylimidazol-1-yl)-2-pyridinyl]-N-[(1S)-1-(4-methoxyphenyl)ethyl]-4-methylpyridazin-3-amine (CAS 1914989-80-2) is a chemical compound with the molecular formula C24H26N6O2 and a molecular weight of 430.5 g/mol. IUPAC name: 6-[6-methoxy-5-(4-methylimidazol-1-yl)-2-pyridinyl]-N-[(1S)-1-(4-methoxyphenyl)ethyl]-4-methylpyridazin-3-amine. InChIKey: LUJVPGJMVNXPHO-KRWDZBQOSA-N.
| Molecular formula | C24H26N6O2 |
|---|---|
| Molecular weight | 430.5 g/mol |
| IUPAC name | 6-[6-methoxy-5-(4-methylimidazol-1-yl)-2-pyridinyl]-N-[(1S)-1-(4-methoxyphenyl)ethyl]-4-methylpyridazin-3-amine |
| InChIKey | LUJVPGJMVNXPHO-KRWDZBQOSA-N |
| SMILES | CC1=CC(=NN=C1N[C@@H](C)C2=CC=C(C=C2)OC)C3=NC(=C(C=C3)N4C=C(N=C4)C)OC |
Computed by PubChem (NCBI)