CAS 552325-73-2 appears in our catalog under these names: A-674563/ 99.21% (existing batch purity), A–674563, A-674563 (free base), A-674563, A-674563 99%. Offered by: TargetMol, GLPBio, Chemat, Biosynth, Ambeed. Available pack sizes: 1mg, 5mg, 10mg, 100mg, 10mM (in 1ml dmso), 50mg, 25mg, 250mg.
(2S)-1-[[5-(3-methyl-2H-indazol-5-yl)-3-pyridinyl]oxy]-3-phenylpropan-2-amine (CAS 552325-73-2) is a chemical compound with the molecular formula C22H22N4O and a molecular weight of 358.4 g/mol. IUPAC name: (2S)-1-[[5-(3-methyl-2H-indazol-5-yl)-3-pyridinyl]oxy]-3-phenylpropan-2-amine. InChIKey: BPNUQXPIQBZCMR-IBGZPJMESA-N.
| Molecular formula | C22H22N4O |
|---|---|
| Molecular weight | 358.4 g/mol |
| IUPAC name | (2S)-1-[[5-(3-methyl-2H-indazol-5-yl)-3-pyridinyl]oxy]-3-phenylpropan-2-amine |
| InChIKey | BPNUQXPIQBZCMR-IBGZPJMESA-N |
| SMILES | CC1=C2C=C(C=CC2=NN1)C3=CC(=CN=C3)OC[C@H](CC4=CC=CC=C4)N |
Computed by PubChem (NCBI)