CAS 1000279-69-5 appears in our catalog under these names: A-867744/ 95.66% (existing batch purity), A–867744, A 867744, A-867744 98%, 4-[5-(4-Chlorophenyl)-2-methyl-3-(1-oxopropyl)-1H-pyrrol-1-yl]benzenesulfonamide, 98%, 98%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 100 mg, 10 mg.
4-[5-(4-chlorophenyl)-2-methyl-3-propanoylpyrrol-1-yl]benzenesulfonamide (CAS 1000279-69-5) is a chemical compound with the molecular formula C20H19ClN2O3S and a molecular weight of 402.9 g/mol. IUPAC name: 4-[5-(4-chlorophenyl)-2-methyl-3-propanoylpyrrol-1-yl]benzenesulfonamide. InChIKey: ABACVOXFUHDKNZ-UHFFFAOYSA-N.
| Molecular formula | C20H19ClN2O3S |
|---|---|
| Molecular weight | 402.9 g/mol |
| IUPAC name | 4-[5-(4-chlorophenyl)-2-methyl-3-propanoylpyrrol-1-yl]benzenesulfonamide |
| InChIKey | ABACVOXFUHDKNZ-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1=C(N(C(=C1)C2=CC=C(C=C2)Cl)C3=CC=C(C=C3)S(=O)(=O)N)C |
Computed by PubChem (NCBI)