CAS 41552-95-8 appears in our catalog under these names: A2AR-agonist-1/ 99.82% (existing batch purity), A2AR–agonist–1, A2AR-agonist-1, A2AR-agonist-1 99%, A2AR-agonist-1, 99.90%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg.
(2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-[2-(1H-indol-3-yl)ethylamino]purin-9-yl]oxolane-3,4-diol (CAS 41552-95-8) is a chemical compound with the molecular formula C20H22N6O4 and a molecular weight of 410.4 g/mol. IUPAC name: (2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-[2-(1H-indol-3-yl)ethylamino]purin-9-yl]oxolane-3,4-diol. InChIKey: QGCNEMXXKWZPHR-WVSUBDOOSA-N.
| Molecular formula | C20H22N6O4 |
|---|---|
| Molecular weight | 410.4 g/mol |
| IUPAC name | (2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-[2-(1H-indol-3-yl)ethylamino]purin-9-yl]oxolane-3,4-diol |
| InChIKey | QGCNEMXXKWZPHR-WVSUBDOOSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CCNC3=C4C(=NC=N3)N(C=N4)[C@H]5[C@@H]([C@@H]([C@H](O5)CO)O)O |
Computed by PubChem (NCBI)