CAS 269390-77-4 appears in our catalog under these names: AAL-993/ 99.06% (existing batch purity), AAL–993, AAL993 95%, AAL-993, 95%, 95%, AAL993, 99.14%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg.
2-(pyridin-4-ylmethylamino)-N-[3-(trifluoromethyl)phenyl]benzamide (CAS 269390-77-4) is a chemical compound with the molecular formula C20H16F3N3O and a molecular weight of 371.4 g/mol. IUPAC name: 2-(pyridin-4-ylmethylamino)-N-[3-(trifluoromethyl)phenyl]benzamide. InChIKey: BLAFVGLBBOPRLP-UHFFFAOYSA-N.
| Molecular formula | C20H16F3N3O |
|---|---|
| Molecular weight | 371.4 g/mol |
| IUPAC name | 2-(pyridin-4-ylmethylamino)-N-[3-(trifluoromethyl)phenyl]benzamide |
| InChIKey | BLAFVGLBBOPRLP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)NC2=CC=CC(=C2)C(F)(F)F)NCC3=CC=NC=C3 |
Computed by PubChem (NCBI)