CAS 808756-71-0 appears in our catalog under these names: ABT 102/ 99.72% (existing batch purity), ABT 102, ABT 102, ABT-102, ABT-102, 98.50%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 200mg.
1-[(1R)-5-tert-butyl-2,3-dihydro-1H-inden-1-yl]-3-(1H-indazol-4-yl)urea (CAS 808756-71-0) is a chemical compound with the molecular formula C21H24N4O and a molecular weight of 348.4 g/mol. IUPAC name: 1-[(1R)-5-tert-butyl-2,3-dihydro-1H-inden-1-yl]-3-(1H-indazol-4-yl)urea. InChIKey: TYOYXJNGINZFET-GOSISDBHSA-N.
| Molecular formula | C21H24N4O |
|---|---|
| Molecular weight | 348.4 g/mol |
| IUPAC name | 1-[(1R)-5-tert-butyl-2,3-dihydro-1H-inden-1-yl]-3-(1H-indazol-4-yl)urea |
| InChIKey | TYOYXJNGINZFET-GOSISDBHSA-N |
| SMILES | CC(C)(C)C1=CC2=C(C=C1)[C@@H](CC2)NC(=O)NC3=CC=CC4=C3C=NN4 |
Computed by PubChem (NCBI)