CAS 189498-57-5 appears in our catalog under these names: ABT-080/ 98.15% (existing batch purity), ABT-080. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 25 mg, 50 mg.
Sodium 4,4-bis[4-(quinolin-2-ylmethoxy)phenyl]pentanoate (CAS 189498-57-5) is a chemical compound with the molecular formula C37H31N2NaO4 and a molecular weight of 590.6 g/mol. IUPAC name: sodium 4,4-bis[4-(quinolin-2-ylmethoxy)phenyl]pentanoate. InChIKey: IQIPMOPRODKMFM-UHFFFAOYSA-M.
| Molecular formula | C37H31N2NaO4 |
|---|---|
| Molecular weight | 590.6 g/mol |
| IUPAC name | sodium 4,4-bis[4-(quinolin-2-ylmethoxy)phenyl]pentanoate |
| InChIKey | IQIPMOPRODKMFM-UHFFFAOYSA-M |
| SMILES | CC(CCC(=O)[O-])(C1=CC=C(C=C1)OCC2=NC3=CC=CC=C3C=C2)C4=CC=C(C=C4)OCC5=NC6=CC=CC=C6C=C5.[Na+] |
Computed by PubChem (NCBI)