CAS 1421854-16-1 appears in our catalog under these names: AC-186/ 99.53% (existing batch purity), AC 186, AC 186, AC-186 99%, 4-(4,4-Difluoro-1-(2-fluorophenyl)cyclohexyl)phenol, 99%, 99%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 5 mg, 25 mg.
4-[4,4-difluoro-1-(2-fluorophenyl)cyclohexyl]phenol (CAS 1421854-16-1) is a chemical compound with the molecular formula C18H17F3O and a molecular weight of 306.3 g/mol. IUPAC name: 4-[4,4-difluoro-1-(2-fluorophenyl)cyclohexyl]phenol. InChIKey: HSMUKSLNDJOZQG-UHFFFAOYSA-N.
| Molecular formula | C18H17F3O |
|---|---|
| Molecular weight | 306.3 g/mol |
| IUPAC name | 4-[4,4-difluoro-1-(2-fluorophenyl)cyclohexyl]phenol |
| InChIKey | HSMUKSLNDJOZQG-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1(C2=CC=C(C=C2)O)C3=CC=CC=C3F)(F)F |
Computed by PubChem (NCBI)