CAS 1609389-52-7 appears in our catalog under these names: ACY-957/ 98.24% (existing batch purity), ACY–957, ACY-957 98%, N-[2-Amino-5-(2-thienyl)phenyl]-2-(1-piperazinyl)-6-quinolinecarboxamide, 98%, 98%, ACY-957, 99.63%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso).
N-(2-amino-5-thiophen-2-ylphenyl)-2-piperazin-1-ylquinoline-6-carboxamide (CAS 1609389-52-7) is a chemical compound with the molecular formula C24H23N5OS and a molecular weight of 429.5 g/mol. IUPAC name: N-(2-amino-5-thiophen-2-ylphenyl)-2-piperazin-1-ylquinoline-6-carboxamide. InChIKey: VURDNNVAYZDGDK-UHFFFAOYSA-N.
| Molecular formula | C24H23N5OS |
|---|---|
| Molecular weight | 429.5 g/mol |
| IUPAC name | N-(2-amino-5-thiophen-2-ylphenyl)-2-piperazin-1-ylquinoline-6-carboxamide |
| InChIKey | VURDNNVAYZDGDK-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=NC3=C(C=C2)C=C(C=C3)C(=O)NC4=C(C=CC(=C4)C5=CC=CS5)N |
Computed by PubChem (NCBI)