CAS 1997158-25-4 appears in our catalog under these names: AChE/BuChE–IN–4, AChE/BuChE-IN-4, 99.66%, AChE/BuChE-IN-4/ 99.89% (existing batch purity), N4-((1-Benzylpiperidin-4-yl)methyl)pyrimidine-2,4-diamine, 95%, 95%. Offered by: GLPBio, MedChemExpress, TargetMol, Chemat. Available pack sizes: 1mg, 10mg, 5mg, 50mg, 100 mg, 5 mg, 50 mg, 10 mg.
4-N-[(1-benzylpiperidin-4-yl)methyl]pyrimidine-2,4-diamine (CAS 1997158-25-4) is a chemical compound with the molecular formula C17H23N5 and a molecular weight of 297.4 g/mol. IUPAC name: 4-N-[(1-benzylpiperidin-4-yl)methyl]pyrimidine-2,4-diamine. InChIKey: UOIHYBDULIXVAR-UHFFFAOYSA-N.
| Molecular formula | C17H23N5 |
|---|---|
| Molecular weight | 297.4 g/mol |
| IUPAC name | 4-N-[(1-benzylpiperidin-4-yl)methyl]pyrimidine-2,4-diamine |
| InChIKey | UOIHYBDULIXVAR-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1CNC2=NC(=NC=C2)N)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)