CAS 294648-66-1 appears in our catalog under these names: ADAMTS–5–IN–2, ADAMTS-5-IN-2, 98.73%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 10mM (in 1ml dmso), 5 mg, 50 mg, 10mM/1mL, 25 mg.
5-ethyl-5'-phenylspiro[1H-indole-3,2'-3H-1,3,4-thiadiazole]-2-one (CAS 294648-66-1) is a chemical compound with the molecular formula C17H15N3OS and a molecular weight of 309.4 g/mol. IUPAC name: 5-ethyl-5'-phenylspiro[1H-indole-3,2'-3H-1,3,4-thiadiazole]-2-one. InChIKey: ICJWVAKZQXYHBB-UHFFFAOYSA-N.
| Molecular formula | C17H15N3OS |
|---|---|
| Molecular weight | 309.4 g/mol |
| IUPAC name | 5-ethyl-5'-phenylspiro[1H-indole-3,2'-3H-1,3,4-thiadiazole]-2-one |
| InChIKey | ICJWVAKZQXYHBB-UHFFFAOYSA-N |
| SMILES | CCC1=CC2=C(C=C1)NC(=O)C23NN=C(S3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)