Products 1146290-00-7
CAS 1146290-00-7 is the registry number for N-Benzyl-3-(2-sulfanyl-1H-imidazol-1-yl)benzamide. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
N-benzyl-3-(2-sulfanylidene-1H-imidazol-3-yl)benzamide (CAS 1146290-00-7) is a chemical compound with the molecular formula C17H15N3OS and a molecular weight of 309.4 g/mol. IUPAC name: N-benzyl-3-(2-sulfanylidene-1H-imidazol-3-yl)benzamide. InChIKey: ZSRVMUIXFOJUDM-UHFFFAOYSA-N.
| Molecular formula | C17H15N3OS |
|---|---|
| Molecular weight | 309.4 g/mol |
| IUPAC name | N-benzyl-3-(2-sulfanylidene-1H-imidazol-3-yl)benzamide |
| InChIKey | ZSRVMUIXFOJUDM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC(=O)C2=CC(=CC=C2)N3C=CNC3=S |
Computed by PubChem (NCBI)